cas: 517905-86-1 — see every product listed under this CAS number, including other names
(R)-3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(2-(trifluoromethyl)phenyl)propanoic acid, 95% (CAS 517905-86-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100mg, 250mg, 50mg, 500mg. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | JD-7047-1g |
| cas | 517905-86-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 100mg | price on request | |
| Combi-blocks | 250mg | price on request | |
| Fluorochem | 50mg | 388.42 Pln | |
| Fluorochem | 100mg | 497.76 Pln | |
| Fluorochem | 250mg | 721.64 Pln | |
| Fluorochem | 500mg | 1247.50 Pln | |
| Fluorochem | 1g | 1705.67 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
(3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[2-(trifluoromethyl)phenyl]propanoic acid (CAS 517905-86-1) is a chemical compound with the molecular formula C25H20F3NO4 and a molecular weight of 455.4 g/mol. IUPAC name: (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[2-(trifluoromethyl)phenyl]propanoic acid. InChIKey: WUSGYGWDKAFPBR-JOCHJYFZSA-N.
| Molecular formula | C25H20F3NO4 |
|---|---|
| Molecular weight | 455.4 g/mol |
| IUPAC name | (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[2-(trifluoromethyl)phenyl]propanoic acid |
| InChIKey | WUSGYGWDKAFPBR-JOCHJYFZSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CC(=O)O)C4=CC=CC=C4C(F)(F)F |
Computed by PubChem (NCBI)