cas: 517905-86-1 — see every product listed under this CAS number, including other names
Fmoc-D-β-Phe(2-CF3)-OH 98% (CAS 517905-86-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A298281-100mg |
| cas | 517905-86-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 509.44 Pln | |
| Ambeed | 250mg | 731.94 Pln | |
| Ambeed | 1g | 1716.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A298281 |
(3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[2-(trifluoromethyl)phenyl]propanoic acid (CAS 517905-86-1) is a chemical compound with the molecular formula C25H20F3NO4 and a molecular weight of 455.4 g/mol. IUPAC name: (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[2-(trifluoromethyl)phenyl]propanoic acid. InChIKey: WUSGYGWDKAFPBR-JOCHJYFZSA-N.
| Molecular formula | C25H20F3NO4 |
|---|---|
| Molecular weight | 455.4 g/mol |
| IUPAC name | (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[2-(trifluoromethyl)phenyl]propanoic acid |
| InChIKey | WUSGYGWDKAFPBR-JOCHJYFZSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CC(=O)O)C4=CC=CC=C4C(F)(F)F |
Computed by PubChem (NCBI)