cas: 144119-12-0 — see every product listed under this CAS number, including other names
(R)–(–)–2–(Hydroxy(diphenyl)methyl)–1–methylpyrrolidine (CAS 144119-12-0) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1g, 250mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GD14186-10g |
| cas | 144119-12-0 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 10g | 3082.39 Pln | |
| GLPBio | 1g | 821.70 Pln | |
| GLPBio | 250mg | 526.83 Pln | |
| GLPBio | 5g | 1893.54 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
[(2R)-1-methylpyrrolidin-2-yl]-diphenylmethanol (CAS 144119-12-0) is a chemical compound with the molecular formula C18H21NO and a molecular weight of 267.4 g/mol. IUPAC name: [(2R)-1-methylpyrrolidin-2-yl]-diphenylmethanol. InChIKey: XIJAGFLYYNXCAB-QGZVFWFLSA-N.
| Molecular formula | C18H21NO |
|---|---|
| Molecular weight | 267.4 g/mol |
| IUPAC name | [(2R)-1-methylpyrrolidin-2-yl]-diphenylmethanol |
| InChIKey | XIJAGFLYYNXCAB-QGZVFWFLSA-N |
| SMILES | CN1CCC[C@@H]1C(C2=CC=CC=C2)(C3=CC=CC=C3)O |
Computed by PubChem (NCBI)