cas: 144119-12-0 — see every product listed under this CAS number, including other names
(R)-(1-Methylpyrrolidin-2-yl)diphenylmethanol, 98%, 98% (CAS 144119-12-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112IYB-250mg |
| cas | 144119-12-0 |
| size | 250mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 189.20 Pln | |
| Chemat | 25g | 717.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
[(2R)-1-methylpyrrolidin-2-yl]-diphenylmethanol (CAS 144119-12-0) is a chemical compound with the molecular formula C18H21NO and a molecular weight of 267.4 g/mol. IUPAC name: [(2R)-1-methylpyrrolidin-2-yl]-diphenylmethanol. InChIKey: XIJAGFLYYNXCAB-QGZVFWFLSA-N.
| Molecular formula | C18H21NO |
|---|---|
| Molecular weight | 267.4 g/mol |
| IUPAC name | [(2R)-1-methylpyrrolidin-2-yl]-diphenylmethanol |
| InChIKey | XIJAGFLYYNXCAB-QGZVFWFLSA-N |
| SMILES | CN1CCC[C@@H]1C(C2=CC=CC=C2)(C3=CC=CC=C3)O |
Computed by PubChem (NCBI)