cas: 536747-87-2 — see every product listed under this CAS number, including other names
(R)–1–(tert–Butoxycarbonyl)–4,4–difluoropyrrolidine–2–carboxylic acid (CAS 536747-87-2) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1g, 250mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GB51349-10g |
| cas | 536747-87-2 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 10g | 4612.91 Pln | |
| GLPBio | 1g | 1261.67 Pln | |
| GLPBio | 250mg | 826.38 Pln | |
| GLPBio | 5g | 2516.04 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
(2R)-4,4-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid (CAS 536747-87-2) is a chemical compound with the molecular formula C10H15F2NO4 and a molecular weight of 251.23 g/mol. IUPAC name: (2R)-4,4-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid. InChIKey: WTMZYKCXBXPVPT-ZCFIWIBFSA-N.
| Molecular formula | C10H15F2NO4 |
|---|---|
| Molecular weight | 251.23 g/mol |
| IUPAC name | (2R)-4,4-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
| InChIKey | WTMZYKCXBXPVPT-ZCFIWIBFSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C[C@@H]1C(=O)O)(F)F |
Computed by PubChem (NCBI)