cas: 536747-87-2 — see every product listed under this CAS number, including other names
(R)-1-(TERT-BUTOXYCARBONYL)-4,4-DIFLUOROPYRROLIDINE-2-CARBOXYLIC ACID, 95% (CAS 536747-87-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F388131-250MG |
| cas | 536747-87-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 232.23 Pln | |
| Fluorochem | 1g | 497.76 Pln | |
| Fluorochem | 5g | 1549.47 Pln | |
| Fluorochem | 10g | 2715.73 Pln | |
| Fluorochem | 25g | 5975.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
(2R)-4,4-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid (CAS 536747-87-2) is a chemical compound with the molecular formula C10H15F2NO4 and a molecular weight of 251.23 g/mol. IUPAC name: (2R)-4,4-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid. InChIKey: WTMZYKCXBXPVPT-ZCFIWIBFSA-N.
| Molecular formula | C10H15F2NO4 |
|---|---|
| Molecular weight | 251.23 g/mol |
| IUPAC name | (2R)-4,4-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
| InChIKey | WTMZYKCXBXPVPT-ZCFIWIBFSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C[C@@H]1C(=O)O)(F)F |
Computed by PubChem (NCBI)