cas: 131690-61-4 — see every product listed under this CAS number, including other names
(R)–3–Amino–3–(4–chlorophenyl)propanoic acid (CAS 131690-61-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GF50086-100mg |
| cas | 131690-61-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100mg | 508.11 Pln | |
| GLPBio | 1g | 784.26 Pln | |
| GLPBio | 250mg | 606.40 Pln | |
| GLPBio | 5g | 1645.47 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
(3R)-3-amino-3-(4-chlorophenyl)propanoic acid (CAS 131690-61-4) is a chemical compound with the molecular formula C9H10ClNO2 and a molecular weight of 199.63 g/mol. IUPAC name: (3R)-3-amino-3-(4-chlorophenyl)propanoic acid. InChIKey: BXGDBHAMTMMNTO-MRVPVSSYSA-N.
| Molecular formula | C9H10ClNO2 |
|---|---|
| Molecular weight | 199.63 g/mol |
| IUPAC name | (3R)-3-amino-3-(4-chlorophenyl)propanoic acid |
| InChIKey | BXGDBHAMTMMNTO-MRVPVSSYSA-N |
| SMILES | C1=CC(=CC=C1[C@@H](CC(=O)O)N)Cl |
Computed by PubChem (NCBI)