CAS 101349-30-8 appears in our catalog under these names: (4-Amino-3-chloro-phenyl)-acetic acid methyl ester, 95%, Methyl 2-(4-amino-3-chlorophenyl)acetate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g, 10g.
Methyl 2-(4-amino-3-chlorophenyl)acetate (CAS 101349-30-8) is a chemical compound with the molecular formula C9H10ClNO2 and a molecular weight of 199.63 g/mol. IUPAC name: methyl 2-(4-amino-3-chlorophenyl)acetate. InChIKey: FDEHBKRHLQPVSL-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO2 |
|---|---|
| Molecular weight | 199.63 g/mol |
| IUPAC name | methyl 2-(4-amino-3-chlorophenyl)acetate |
| InChIKey | FDEHBKRHLQPVSL-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=CC(=C(C=C1)N)Cl |
Computed by PubChem (NCBI)