CAS 2287273-98-5 is the registry number for 1-(Pyridin-4-yl)cyclopropane-1-carboxylic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg, 100mg.
1-pyridin-4-ylcyclopropane-1-carboxylic acid;hydrochloride (CAS 2287273-98-5) is a chemical compound with the molecular formula C9H10ClNO2 and a molecular weight of 199.63 g/mol. IUPAC name: 1-pyridin-4-ylcyclopropane-1-carboxylic acid;hydrochloride. InChIKey: QQZLSQMWICVRRD-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO2 |
|---|---|
| Molecular weight | 199.63 g/mol |
| IUPAC name | 1-pyridin-4-ylcyclopropane-1-carboxylic acid;hydrochloride |
| InChIKey | QQZLSQMWICVRRD-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=CC=NC=C2)C(=O)O.Cl |
Computed by PubChem (NCBI)