cas: 228244-20-0 — see every product listed under this CAS number, including other names
(R)-(+)-1-Boc-2-pyrrolidinecarbonitrile 97% (CAS 228244-20-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A816889-250mg |
| cas | 228244-20-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 192.38 Pln | |
| Ambeed | 1g | 303.62 Pln | |
| Ambeed | 5g | 776.44 Pln | |
| Ambeed | 10g | 1427.25 Pln | |
| Ambeed | 25g | 2745.56 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A816889 |
Tert-butyl (2R)-2-cyanopyrrolidine-1-carboxylate (CAS 228244-20-0) is a chemical compound with the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. IUPAC name: tert-butyl (2R)-2-cyanopyrrolidine-1-carboxylate. InChIKey: MDMSZBHMBCNYNO-MRVPVSSYSA-N.
| Molecular formula | C10H16N2O2 |
|---|---|
| Molecular weight | 196.25 g/mol |
| IUPAC name | tert-butyl (2R)-2-cyanopyrrolidine-1-carboxylate |
| InChIKey | MDMSZBHMBCNYNO-MRVPVSSYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H]1C#N |
Computed by PubChem (NCBI)