cas: 23788-74-1 — see every product listed under this CAS number, including other names
(R)-(2,2-Dimethyl-1,3-dioxolan-4-yl)methyl 4-methylbenzenesulfonate, 96%, 96% (CAS 23788-74-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114C3L-250mg |
| cas | 23788-74-1 |
| size | 250mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 165.20 Pln | |
| Chemat | 10g | 266.00 Pln | |
| Chemat | 25g | 568.40 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate (CAS 23788-74-1) is a chemical compound with the molecular formula C13H18O5S and a molecular weight of 286.35 g/mol. IUPAC name: [(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate. InChIKey: SRKDUHUULIWXFT-LLVKDONJSA-N.
| Molecular formula | C13H18O5S |
|---|---|
| Molecular weight | 286.35 g/mol |
| IUPAC name | [(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate |
| InChIKey | SRKDUHUULIWXFT-LLVKDONJSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC[C@H]2COC(O2)(C)C |
Computed by PubChem (NCBI)