cas: 23788-74-1 — see every product listed under this CAS number, including other names
(R)-(-)-2,2-Dimethyl-1,3-dioxolane-4-ylmethyl p-toluenesulfonate, 96% (CAS 23788-74-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F050905-5G |
| cas | 23788-74-1 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 247.85 Pln | |
| Fluorochem | 10g | 414.46 Pln | |
| Fluorochem | 25g | 919.49 Pln | |
| Fluorochem | 100g | 3507.12 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate (CAS 23788-74-1) is a chemical compound with the molecular formula C13H18O5S and a molecular weight of 286.35 g/mol. IUPAC name: [(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate. InChIKey: SRKDUHUULIWXFT-LLVKDONJSA-N.
| Molecular formula | C13H18O5S |
|---|---|
| Molecular weight | 286.35 g/mol |
| IUPAC name | [(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate |
| InChIKey | SRKDUHUULIWXFT-LLVKDONJSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC[C@H]2COC(O2)(C)C |
Computed by PubChem (NCBI)