cas: 136918-07-5 — see every product listed under this CAS number, including other names
(R)-1-((tert-Butyldimethylsilyl)oxy)propan-2-ol, 98% (CAS 136918-07-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch118LYB-100mg |
| cas | 136918-07-5 |
| size | 100mg |
| availability | 2g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1734.80 Pln | |
| Chemat | 250mg | 2450.00 Pln | |
| Chemat | 500mg | 3832.40 Pln | |
| Chemat | 1g | 4893.20 Pln | |
| Fluorochem | 100mg | 2210.70 Pln | |
| Fluorochem | 250mg | 3137.45 Pln | |
| Fluorochem | 500mg | 4866.01 Pln | |
| Fluorochem | 1g | 6230.12 Pln | |
| Fluorochem | 5g | 17580.29 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2R)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-ol (CAS 136918-07-5) is a chemical compound with the molecular formula C9H22O2Si and a molecular weight of 190.35 g/mol. IUPAC name: (2R)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-ol. InChIKey: BJDDRAYUVSVPPR-MRVPVSSYSA-N.
| Molecular formula | C9H22O2Si |
|---|---|
| Molecular weight | 190.35 g/mol |
| IUPAC name | (2R)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-ol |
| InChIKey | BJDDRAYUVSVPPR-MRVPVSSYSA-N |
| SMILES | C[C@H](CO[Si](C)(C)C(C)(C)C)O |
Computed by PubChem (NCBI)