CAS 135614-57-2 is the registry number for (S)-2-((tert-butyldimethylsilyl)oxy)propan-1-ol, 95%. Offered by: AmBeed. Available pack sizes: 5g, 100mg, 250mg, 1g.
(2S)-2-[tert-butyl(dimethyl)silyl]oxypropan-1-ol (CAS 135614-57-2) is a chemical compound with the molecular formula C9H22O2Si and a molecular weight of 190.35 g/mol. IUPAC name: (2S)-2-[tert-butyl(dimethyl)silyl]oxypropan-1-ol. InChIKey: FRYOCKYIGKFINL-QMMMGPOBSA-N.
| Molecular formula | C9H22O2Si |
|---|---|
| Molecular weight | 190.35 g/mol |
| IUPAC name | (2S)-2-[tert-butyl(dimethyl)silyl]oxypropan-1-ol |
| InChIKey | FRYOCKYIGKFINL-QMMMGPOBSA-N |
| SMILES | C[C@@H](CO)O[Si](C)(C)C(C)(C)C |
Computed by PubChem (NCBI)