CAS 113534-13-7 appears in our catalog under these names: (S)-1-((tert-Butyldimethylsilyl)oxy)propan-2-ol, 97%, 2-PROPANOL, 1-[[(1,1-DIMETHYLETHYL)DIMETHYLSILYL]OXY]-, (2S)-, 95%. Offered by: AmBeed, Fluorochem. Available pack sizes: 50mg, 250mg, 1g.
(2S)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-ol (CAS 113534-13-7) is a chemical compound with the molecular formula C9H22O2Si and a molecular weight of 190.35 g/mol. IUPAC name: (2S)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-ol. InChIKey: BJDDRAYUVSVPPR-QMMMGPOBSA-N.
| Molecular formula | C9H22O2Si |
|---|---|
| Molecular weight | 190.35 g/mol |
| IUPAC name | (2S)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-ol |
| InChIKey | BJDDRAYUVSVPPR-QMMMGPOBSA-N |
| SMILES | C[C@@H](CO[Si](C)(C)C(C)(C)C)O |
Computed by PubChem (NCBI)