cas: 216002-20-9 — see every product listed under this CAS number, including other names
(R)-1-(3,5-Bis(trifluoromethyl)phenyl)ethanamine hydrochloride 97% (CAS 216002-20-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A170856-100mg |
| cas | 216002-20-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 303.62 Pln | |
| Ambeed | 250mg | 353.69 Pln | |
| Ambeed | 1g | 720.81 Pln | |
| Ambeed | 5g | 2133.69 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A170856 |
(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethanamine;hydrochloride (CAS 216002-20-9) is a chemical compound with the molecular formula C10H10ClF6N and a molecular weight of 293.63 g/mol. IUPAC name: (1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethanamine;hydrochloride. InChIKey: DWSPCWWXKNPRFN-NUBCRITNSA-N.
| Molecular formula | C10H10ClF6N |
|---|---|
| Molecular weight | 293.63 g/mol |
| IUPAC name | (1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethanamine;hydrochloride |
| InChIKey | DWSPCWWXKNPRFN-NUBCRITNSA-N |
| SMILES | C[C@H](C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)