cas: 216002-20-9 — see every product listed under this CAS number, including other names
(R)-1-(3,5-BIS(TRIFLUOROMETHYL)PHENYL)ETHANAMINE HCL, 97% (CAS 216002-20-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F386233-250MG |
| cas | 216002-20-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 341.56 Pln | |
| Fluorochem | 1g | 706.02 Pln | |
| Fluorochem | 5g | 2132.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethanamine;hydrochloride (CAS 216002-20-9) is a chemical compound with the molecular formula C10H10ClF6N and a molecular weight of 293.63 g/mol. IUPAC name: (1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethanamine;hydrochloride. InChIKey: DWSPCWWXKNPRFN-NUBCRITNSA-N.
| Molecular formula | C10H10ClF6N |
|---|---|
| Molecular weight | 293.63 g/mol |
| IUPAC name | (1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethanamine;hydrochloride |
| InChIKey | DWSPCWWXKNPRFN-NUBCRITNSA-N |
| SMILES | C[C@H](C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)