CAS 185332-43-8 is the registry number for 1-(3,5-Bis(trifluoromethyl)phenyl)-n-methylmethanamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
1-[3,5-bis(trifluoromethyl)phenyl]-N-methylmethanamine;hydrochloride (CAS 185332-43-8) is a chemical compound with the molecular formula C10H10ClF6N and a molecular weight of 293.63 g/mol. IUPAC name: 1-[3,5-bis(trifluoromethyl)phenyl]-N-methylmethanamine;hydrochloride. InChIKey: ZHJANDCTQSKVGQ-UHFFFAOYSA-N.
| Molecular formula | C10H10ClF6N |
|---|---|
| Molecular weight | 293.63 g/mol |
| IUPAC name | 1-[3,5-bis(trifluoromethyl)phenyl]-N-methylmethanamine;hydrochloride |
| InChIKey | ZHJANDCTQSKVGQ-UHFFFAOYSA-N |
| SMILES | CNCC1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F.Cl |
Computed by PubChem (NCBI)