(R)-1-(4-(Methylthio)phenyl)ethanamine hydrochloride, 95%
cas: 1391401-54-9 — see every product listed under this CAS number, including other names
(R)-1-(4-(Methylthio)phenyl)ethanamine hydrochloride, 95% (CAS 1391401-54-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A513368-100mg |
| cas | 1391401-54-9 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 693.00 Pln | |
| Ambeed | 250mg | 1010.06 Pln | |
| Ambeed | 1g | 2350.62 Pln | |
| Chemat | 100mg | 630.80 Pln | |
| Chemat | 250mg | 1029.20 Pln | |
| Chemat | 1g | 2666.00 Pln | |
| BLDpharm | 100mg | 741.99 Pln | |
| BLDpharm | 250mg | 1086.31 Pln | |
| BLDpharm | 1g | 2530.24 Pln | |
| Fluorochem | 100mg | 1164.19 Pln | |
| Fluorochem | 250mg | 1898.31 Pln | |
| Fluorochem | 1g | 4944.11 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
(1R)-1-(4-methylsulfanylphenyl)ethanamine;hydrochloride (CAS 1391401-54-9) is a chemical compound with the molecular formula C9H14ClNS and a molecular weight of 203.73 g/mol. IUPAC name: (1R)-1-(4-methylsulfanylphenyl)ethanamine;hydrochloride. InChIKey: FIKZELFTBUJWNB-OGFXRTJISA-N.
| Molecular formula | C9H14ClNS |
|---|---|
| Molecular weight | 203.73 g/mol |
| IUPAC name | (1R)-1-(4-methylsulfanylphenyl)ethanamine;hydrochloride |
| InChIKey | FIKZELFTBUJWNB-OGFXRTJISA-N |
| SMILES | C[C@H](C1=CC=C(C=C1)SC)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
(R)-1-(4-(Methylthio)phenyl)ethanamine hydrochloride, (1R)-1-[4-(methylsulfanyl)phenyl]ethan-1-amine hydrochloride, (1R)-1-(4-methylsulfanylphenyl)ethanamine;hydrochloride, (R)-1-[4-(Methylthio)phenyl]ethanamine Hydrochloride, (R)-1-(4-(methylthio)phenyl)ethanamine HCl, (R)-1-(4-(Methylthio)phenyl)ethanaminehydrochloride, (R)-1-(4-(methylthio)phenyl)ethan-1-amine hydrochloride, (1R)-1-[4-(Methylsulfanyl)phenyl]ethan-1-amine--hydrogen chloride (1/1)