CAS 1391401-54-9 appears in our catalog under these names: (1R)-1-(4-(Methylsulfanyl)phenyl)ethan-1-amine hydrochloride, (R)-1-(4-(Methylthio)phenyl)ethanamine hydrochloride, 95%, 95%, (R)-1-(4-(Methylthio)phenyl)ethanamine hydrochloride, 95%. Offered by: Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 50mg, 0,5g, 100mg, 250mg, 1g.
(1R)-1-(4-methylsulfanylphenyl)ethanamine;hydrochloride (CAS 1391401-54-9) is a chemical compound with the molecular formula C9H14ClNS and a molecular weight of 203.73 g/mol. IUPAC name: (1R)-1-(4-methylsulfanylphenyl)ethanamine;hydrochloride. InChIKey: FIKZELFTBUJWNB-OGFXRTJISA-N.
| Molecular formula | C9H14ClNS |
|---|---|
| Molecular weight | 203.73 g/mol |
| IUPAC name | (1R)-1-(4-methylsulfanylphenyl)ethanamine;hydrochloride |
| InChIKey | FIKZELFTBUJWNB-OGFXRTJISA-N |
| SMILES | C[C@H](C1=CC=C(C=C1)SC)N.Cl |
Computed by PubChem (NCBI)