CAS 1206910-91-9 appears in our catalog under these names: (S)–1–(4–(Methylthio)phenyl)ethanamine hydrochloride, (S)-1-(4-(Methylthio)phenyl)ethanamine Hydrochloride, (S)-1-(4-(Methylthio)phenyl)ethanamine hydrochloride, 98%, 98%, (S)-1-(4-(Methylthio)phenyl)ethan-1-amine hydrochloride, 98%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 5g, 0,5g, 250mg, 1g.
(1S)-1-(4-methylsulfanylphenyl)ethanamine;hydrochloride (CAS 1206910-91-9) is a chemical compound with the molecular formula C9H14ClNS and a molecular weight of 203.73 g/mol. IUPAC name: (1S)-1-(4-methylsulfanylphenyl)ethanamine;hydrochloride. InChIKey: FIKZELFTBUJWNB-FJXQXJEOSA-N.
| Molecular formula | C9H14ClNS |
|---|---|
| Molecular weight | 203.73 g/mol |
| IUPAC name | (1S)-1-(4-methylsulfanylphenyl)ethanamine;hydrochloride |
| InChIKey | FIKZELFTBUJWNB-FJXQXJEOSA-N |
| SMILES | C[C@@H](C1=CC=C(C=C1)SC)N.Cl |
Computed by PubChem (NCBI)