cas: 64265-77-6 — see every product listed under this CAS number, including other names
(R)-1-(4-Bromophenyl)ethanamine hydrochloride, 98% (CAS 64265-77-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F323877-1G |
| cas | 64265-77-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 294.71 Pln | |
| Fluorochem | 5g | 362.39 Pln | |
| Fluorochem | 25g | 1226.67 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(1R)-1-(4-bromophenyl)ethanamine;hydrochloride (CAS 64265-77-6) is a chemical compound with the molecular formula C8H11BrClN and a molecular weight of 236.53 g/mol. IUPAC name: (1R)-1-(4-bromophenyl)ethanamine;hydrochloride. InChIKey: BQCAANUXMMQVAY-FYZOBXCZSA-N.
| Molecular formula | C8H11BrClN |
|---|---|
| Molecular weight | 236.53 g/mol |
| IUPAC name | (1R)-1-(4-bromophenyl)ethanamine;hydrochloride |
| InChIKey | BQCAANUXMMQVAY-FYZOBXCZSA-N |
| SMILES | C[C@H](C1=CC=C(C=C1)Br)N.Cl |
Computed by PubChem (NCBI)