CAS 64265-77-6 appears in our catalog under these names: (R)-(+)-1-(4-Bromophenyl)ethylamine hydrochloride, 98%, (R)–1–(4–Bromophenyl)ethylamine Hydrochloride, (R)-(+)-1-(4-Bromophenyl)ethylamine hydrochloride, (R)-1-(4-Bromophenyl)ethylamine Hydrochloride 95%, Benzenemethanamine, 4-bromo-α-methyl-, hydrochloride (1:1), (αR)-, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 25g, 1g, 5g, 10g, 250mg.
(1R)-1-(4-bromophenyl)ethanamine;hydrochloride (CAS 64265-77-6) is a chemical compound with the molecular formula C8H11BrClN and a molecular weight of 236.53 g/mol. IUPAC name: (1R)-1-(4-bromophenyl)ethanamine;hydrochloride. InChIKey: BQCAANUXMMQVAY-FYZOBXCZSA-N.
| Molecular formula | C8H11BrClN |
|---|---|
| Molecular weight | 236.53 g/mol |
| IUPAC name | (1R)-1-(4-bromophenyl)ethanamine;hydrochloride |
| InChIKey | BQCAANUXMMQVAY-FYZOBXCZSA-N |
| SMILES | C[C@H](C1=CC=C(C=C1)Br)N.Cl |
Computed by PubChem (NCBI)