CAS 84499-77-4 appears in our catalog under these names: (S)–1–(4–Bromophenyl)ethanamine hydrochloride, (S)-1-(4-bromophenyl)ethanamine hydrochloride, (S)-1-(4-Bromophenyl)ethanamine hydrochloride, 95%, (S)-1-(4-Bromophenyl)ethanamine hydrochloride 97%, (S)-1-(4-Bromophenyl)ethanamine hydrochloride, 97%. Offered by: GLPBio, Biosynth, Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 1g, 2,5g, 0,25g, 5g, 25g, 10g, 100g, 100mg.
(1S)-1-(4-bromophenyl)ethanamine;hydrochloride (CAS 84499-77-4) is a chemical compound with the molecular formula C8H11BrClN and a molecular weight of 236.53 g/mol. IUPAC name: (1S)-1-(4-bromophenyl)ethanamine;hydrochloride. InChIKey: BQCAANUXMMQVAY-RGMNGODLSA-N.
| Molecular formula | C8H11BrClN |
|---|---|
| Molecular weight | 236.53 g/mol |
| IUPAC name | (1S)-1-(4-bromophenyl)ethanamine;hydrochloride |
| InChIKey | BQCAANUXMMQVAY-RGMNGODLSA-N |
| SMILES | C[C@@H](C1=CC=C(C=C1)Br)N.Cl |
Computed by PubChem (NCBI)