cas: 241488-97-1 — see every product listed under this CAS number, including other names
(R)-1-(Anthracen-9-yl)ethanamine, 95% (CAS 241488-97-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F633733-100MG |
| cas | 241488-97-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 2262.76 Pln | |
| Fluorochem | 250mg | 3356.13 Pln | |
| Fluorochem | 1g | 8265.86 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
(1R)-1-anthracen-9-ylethanamine (CAS 241488-97-1) is a chemical compound with the molecular formula C16H15N and a molecular weight of 221.30 g/mol. IUPAC name: (1R)-1-anthracen-9-ylethanamine. InChIKey: RZLKNOOWSHXPRB-LLVKDONJSA-N.
| Molecular formula | C16H15N |
|---|---|
| Molecular weight | 221.30 g/mol |
| IUPAC name | (1R)-1-anthracen-9-ylethanamine |
| InChIKey | RZLKNOOWSHXPRB-LLVKDONJSA-N |
| SMILES | C[C@H](C1=C2C=CC=CC2=CC3=CC=CC=C31)N |
Computed by PubChem (NCBI)