CAS 241488-97-1 appears in our catalog under these names: (R)-1-Anthracen-9-ylethylamine, 95%, (R)–1–(Anthracen–9–yl)ethanamine. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 100mg, 1g.
(1R)-1-anthracen-9-ylethanamine (CAS 241488-97-1) is a chemical compound with the molecular formula C16H15N and a molecular weight of 221.30 g/mol. IUPAC name: (1R)-1-anthracen-9-ylethanamine. InChIKey: RZLKNOOWSHXPRB-LLVKDONJSA-N.
| Molecular formula | C16H15N |
|---|---|
| Molecular weight | 221.30 g/mol |
| IUPAC name | (1R)-1-anthracen-9-ylethanamine |
| InChIKey | RZLKNOOWSHXPRB-LLVKDONJSA-N |
| SMILES | C[C@H](C1=C2C=CC=CC2=CC3=CC=CC=C31)N |
Computed by PubChem (NCBI)