CAS 82954-09-4 is the registry number for (2,4-Dimethylphenyl)(phenyl)acetonitrile, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-(2,4-dimethylphenyl)-2-phenylacetonitrile (CAS 82954-09-4) is a chemical compound with the molecular formula C16H15N and a molecular weight of 221.30 g/mol. IUPAC name: 2-(2,4-dimethylphenyl)-2-phenylacetonitrile. InChIKey: MUZOOZSDJFIEBR-UHFFFAOYSA-N.
| Molecular formula | C16H15N |
|---|---|
| Molecular weight | 221.30 g/mol |
| IUPAC name | 2-(2,4-dimethylphenyl)-2-phenylacetonitrile |
| InChIKey | MUZOOZSDJFIEBR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C(C#N)C2=CC=CC=C2)C |
Computed by PubChem (NCBI)