cas: 1012067-91-2 — see every product listed under this CAS number, including other names
(R)-1-(PYRIDIN-4-YL)ETHANAMINE HCL, 98% (CAS 1012067-91-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F530398-100MG |
| cas | 1012067-91-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 393.63 Pln | |
| Fluorochem | 250mg | 601.89 Pln | |
| Fluorochem | 1g | 1471.37 Pln | |
| Fluorochem | 5g | 5011.79 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(1R)-1-pyridin-4-ylethanamine;dihydrochloride (CAS 1012067-91-2) is a chemical compound with the molecular formula C7H12Cl2N2 and a molecular weight of 195.09 g/mol. IUPAC name: (1R)-1-pyridin-4-ylethanamine;dihydrochloride. InChIKey: JDRXYBFUHCUEFT-QYCVXMPOSA-N.
| Molecular formula | C7H12Cl2N2 |
|---|---|
| Molecular weight | 195.09 g/mol |
| IUPAC name | (1R)-1-pyridin-4-ylethanamine;dihydrochloride |
| InChIKey | JDRXYBFUHCUEFT-QYCVXMPOSA-N |
| SMILES | C[C@H](C1=CC=NC=C1)N.Cl.Cl |
Computed by PubChem (NCBI)