CAS 40154-80-1 appears in our catalog under these names: (1S)-1-(Pyridin-4-yl)ethan-1-amine dihydrochloride, 95%, (S)–1–(Pyridin–4–yl)ethanamine dihydrochloride, (S)-1-(Pyridin-4-yl)ethanamine diHCl ee. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 250mg, 1g, 5g, 100mg, 2,5g.
(1S)-1-pyridin-4-ylethanamine;dihydrochloride (CAS 40154-80-1) is a chemical compound with the molecular formula C7H12Cl2N2 and a molecular weight of 195.09 g/mol. IUPAC name: (1S)-1-pyridin-4-ylethanamine;dihydrochloride. InChIKey: JDRXYBFUHCUEFT-ILKKLZGPSA-N.
| Molecular formula | C7H12Cl2N2 |
|---|---|
| Molecular weight | 195.09 g/mol |
| IUPAC name | (1S)-1-pyridin-4-ylethanamine;dihydrochloride |
| InChIKey | JDRXYBFUHCUEFT-ILKKLZGPSA-N |
| SMILES | C[C@@H](C1=CC=NC=C1)N.Cl.Cl |
Computed by PubChem (NCBI)