CAS 1012067-91-2 appears in our catalog under these names: (1R)-1-(Pyridin-4-yl)ethan-1-amine dihydrochloride, 97%, (1R)-1-Pyridin-4-ylethanamine hydrochloride, 95%, (R)–1–(Pyridin–4–yl)ethanamine dihydrochloride, (R)-1-(Pyridin-4-yl)ethan-1-amine hydrochloride 98%, (R)-1-(Pyridin-4-yl)ethanamine dihydrochloride, 98%, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg.
(1R)-1-pyridin-4-ylethanamine;dihydrochloride (CAS 1012067-91-2) is a chemical compound with the molecular formula C7H12Cl2N2 and a molecular weight of 195.09 g/mol. IUPAC name: (1R)-1-pyridin-4-ylethanamine;dihydrochloride. InChIKey: JDRXYBFUHCUEFT-QYCVXMPOSA-N.
| Molecular formula | C7H12Cl2N2 |
|---|---|
| Molecular weight | 195.09 g/mol |
| IUPAC name | (1R)-1-pyridin-4-ylethanamine;dihydrochloride |
| InChIKey | JDRXYBFUHCUEFT-QYCVXMPOSA-N |
| SMILES | C[C@H](C1=CC=NC=C1)N.Cl.Cl |
Computed by PubChem (NCBI)