cas: 1417743-49-7 — see every product listed under this CAS number, including other names
(R)-1-(tert-Butoxycarbonyl)-4,4-dimethylpyrrolidine-2-carboxylic acid, 96%, 96% (CAS 1417743-49-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110VM1-100mg |
| cas | 1417743-49-7 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 501.20 Pln | |
| Chemat | 250mg | 803.60 Pln | |
| Chemat | 500mg | 1408.40 Pln | |
| Chemat | 1g | 2066.00 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
(2R)-4,4-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid (CAS 1417743-49-7) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: (2R)-4,4-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid. InChIKey: ACHKRIQLSCPKKK-MRVPVSSYSA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | (2R)-4,4-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
| InChIKey | ACHKRIQLSCPKKK-MRVPVSSYSA-N |
| SMILES | CC1(C[C@@H](N(C1)C(=O)OC(C)(C)C)C(=O)O)C |
Computed by PubChem (NCBI)