cas: 1306763-29-0 — see every product listed under this CAS number, including other names
(R)-1-Amino-2,3-dihydro-1H-indene-4-carbonitrile hydrochloride, 97% (CAS 1306763-29-0) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F328606-50MG |
| cas | 1306763-29-0 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 1028.82 Pln | |
| Fluorochem | 100mg | 1695.25 Pln | |
| Fluorochem | 250mg | 2814.65 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(1R)-1-amino-2,3-dihydro-1H-indene-4-carbonitrile;hydrochloride (CAS 1306763-29-0) is a chemical compound with the molecular formula C10H11ClN2 and a molecular weight of 194.66 g/mol. IUPAC name: (1R)-1-amino-2,3-dihydro-1H-indene-4-carbonitrile;hydrochloride. InChIKey: NYCLSOKJNLLCHQ-HNCPQSOCSA-N.
| Molecular formula | C10H11ClN2 |
|---|---|
| Molecular weight | 194.66 g/mol |
| IUPAC name | (1R)-1-amino-2,3-dihydro-1H-indene-4-carbonitrile;hydrochloride |
| InChIKey | NYCLSOKJNLLCHQ-HNCPQSOCSA-N |
| SMILES | C1CC2=C(C=CC=C2[C@@H]1N)C#N.Cl |
Computed by PubChem (NCBI)