Products 4138-20-9
CAS 4138-20-9 appears in our catalog under these names: 6-tert-Butyl-2-chloropyridine-3-carbonitrile, 95%, 6-tert-Butyl-2-chloropyridine-3-carbonitrile. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 50mg.
6-tert-butyl-2-chloropyridine-3-carbonitrile (CAS 4138-20-9) is a chemical compound with the molecular formula C10H11ClN2 and a molecular weight of 194.66 g/mol. IUPAC name: 6-tert-butyl-2-chloropyridine-3-carbonitrile. InChIKey: ZGAPRXSQJGVERK-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2 |
|---|---|
| Molecular weight | 194.66 g/mol |
| IUPAC name | 6-tert-butyl-2-chloropyridine-3-carbonitrile |
| InChIKey | ZGAPRXSQJGVERK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NC(=C(C=C1)C#N)Cl |
Computed by PubChem (NCBI)