CAS 405173-68-4 is the registry number for 2-(Chloromethyl)-4,5-dimethyl-1H-benzimidazole, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 10g, 5g.
2-(chloromethyl)-4,5-dimethyl-1H-benzimidazole (CAS 405173-68-4) is a chemical compound with the molecular formula C10H11ClN2 and a molecular weight of 194.66 g/mol. IUPAC name: 2-(chloromethyl)-4,5-dimethyl-1H-benzimidazole. InChIKey: HDTZCVJNZSQFOH-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2 |
|---|---|
| Molecular weight | 194.66 g/mol |
| IUPAC name | 2-(chloromethyl)-4,5-dimethyl-1H-benzimidazole |
| InChIKey | HDTZCVJNZSQFOH-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C1)NC(=N2)CCl)C |
Computed by PubChem (NCBI)