cas: 157528-56-8 — see every product listed under this CAS number, including other names
(R)-1-Benzyl-3-pyrrolidinecarbonitrile 98% (CAS 157528-56-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A349438-100mg |
| cas | 157528-56-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 381.50 Pln | |
| Ambeed | 250mg | 592.88 Pln | |
| Ambeed | 1g | 1299.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A349438 |
(3R)-1-benzylpyrrolidine-3-carbonitrile (CAS 157528-56-8) is a chemical compound with the molecular formula C12H14N2 and a molecular weight of 186.25 g/mol. IUPAC name: (3R)-1-benzylpyrrolidine-3-carbonitrile. InChIKey: RYCQUUNQHVAFSM-LBPRGKRZSA-N.
| Molecular formula | C12H14N2 |
|---|---|
| Molecular weight | 186.25 g/mol |
| IUPAC name | (3R)-1-benzylpyrrolidine-3-carbonitrile |
| InChIKey | RYCQUUNQHVAFSM-LBPRGKRZSA-N |
| SMILES | C1CN(C[C@@H]1C#N)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)