CAS 689277-05-2 is the registry number for 2,6,8-Trimethylquinolin-4-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2,6,8-trimethylquinolin-4-amine (CAS 689277-05-2) is a chemical compound with the molecular formula C12H14N2 and a molecular weight of 186.25 g/mol. IUPAC name: 2,6,8-trimethylquinolin-4-amine. InChIKey: SLSWQXZTEPDTDH-UHFFFAOYSA-N.
| Molecular formula | C12H14N2 |
|---|---|
| Molecular weight | 186.25 g/mol |
| IUPAC name | 2,6,8-trimethylquinolin-4-amine |
| InChIKey | SLSWQXZTEPDTDH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1)C(=CC(=N2)C)N)C |
Computed by PubChem (NCBI)