CAS 65796-52-3 is the registry number for 2,3,4,9-Tetrahydro-1h-carbazol-6-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg.
6,7,8,9-tetrahydro-5H-carbazol-3-amine (CAS 65796-52-3) is a chemical compound with the molecular formula C12H14N2 and a molecular weight of 186.25 g/mol. IUPAC name: 6,7,8,9-tetrahydro-5H-carbazol-3-amine. InChIKey: POYRLWQLOUUKAY-UHFFFAOYSA-N.
| Molecular formula | C12H14N2 |
|---|---|
| Molecular weight | 186.25 g/mol |
| IUPAC name | 6,7,8,9-tetrahydro-5H-carbazol-3-amine |
| InChIKey | POYRLWQLOUUKAY-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C3=C(N2)C=CC(=C3)N |
Computed by PubChem (NCBI)