cas: 122536-75-8 — see every product listed under this CAS number, including other names
(R)-1-Cbz-3-Boc-Aminopyrrolidine 97% (CAS 122536-75-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A267117-1g |
| cas | 122536-75-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 325.88 Pln | |
| Ambeed | 5g | 965.56 Pln | |
| Ambeed | 25g | 3179.44 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A267117 |
Benzyl (3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidine-1-carboxylate (CAS 122536-75-8) is a chemical compound with the molecular formula C17H24N2O4 and a molecular weight of 320.4 g/mol. IUPAC name: benzyl (3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidine-1-carboxylate. InChIKey: VCCUTXNUDLVCTI-CQSZACIVSA-N.
| Molecular formula | C17H24N2O4 |
|---|---|
| Molecular weight | 320.4 g/mol |
| IUPAC name | benzyl (3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidine-1-carboxylate |
| InChIKey | VCCUTXNUDLVCTI-CQSZACIVSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCN(C1)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)