Products 181956-25-2

CAS 181956-25-2 is the registry number for 1-Benzyl-4-boc-piperazine-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

1-benzyl-4-[(2-methylpropan-2-yl)oxycarbonyl]piperazine-2-carboxylic acid (CAS 181956-25-2) is a chemical compound with the molecular formula C17H24N2O4 and a molecular weight of 320.4 g/mol. IUPAC name: 1-benzyl-4-[(2-methylpropan-2-yl)oxycarbonyl]piperazine-2-carboxylic acid. InChIKey: VLRKCGUUHDUPDO-UHFFFAOYSA-N.

Identity
Molecular formulaC17H24N2O4
Molecular weight320.4 g/mol
IUPAC name1-benzyl-4-[(2-methylpropan-2-yl)oxycarbonyl]piperazine-2-carboxylic acid
InChIKeyVLRKCGUUHDUPDO-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCN(C(C1)C(=O)O)CC2=CC=CC=C2

Computed by PubChem (NCBI)