CAS 121370-60-3 appears in our catalog under these names: 1-Benzyl 4-tert-butyl piperazine-1,4-dicarboxylate, 98%, 1-Benzyl 4-tert-butyl piperazine-1,4-dicarboxylate, 98+%, 1-Benzyl 4-tert-butyl piperazine-1,4-dicarboxylate, 95%, 95%, 1-Benzyl 4-tert-butyl piperazine-1,4-dicarboxylate, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg.
1-O-benzyl 4-O-tert-butyl piperazine-1,4-dicarboxylate (CAS 121370-60-3) is a chemical compound with the molecular formula C17H24N2O4 and a molecular weight of 320.4 g/mol. IUPAC name: 1-O-benzyl 4-O-tert-butyl piperazine-1,4-dicarboxylate. InChIKey: MCRCVCVGQNSZST-UHFFFAOYSA-N.
| Molecular formula | C17H24N2O4 |
|---|---|
| Molecular weight | 320.4 g/mol |
| IUPAC name | 1-O-benzyl 4-O-tert-butyl piperazine-1,4-dicarboxylate |
| InChIKey | MCRCVCVGQNSZST-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)