cas: 623586-00-5 — see every product listed under this CAS number, including other names
(R)-1-Cbz-3-methylpiperazine 95% (CAS 623586-00-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A182288-250mg |
| cas | 623586-00-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 186.81 Pln | |
| Ambeed | 25g | 364.81 Pln | |
| Ambeed | 100g | 921.06 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A182288 |
Benzyl (3R)-3-methylpiperazine-1-carboxylate (CAS 623586-00-5) is a chemical compound with the molecular formula C13H18N2O2 and a molecular weight of 234.29 g/mol. IUPAC name: benzyl (3R)-3-methylpiperazine-1-carboxylate. InChIKey: JRPIQMPFKMFAOX-LLVKDONJSA-N.
| Molecular formula | C13H18N2O2 |
|---|---|
| Molecular weight | 234.29 g/mol |
| IUPAC name | benzyl (3R)-3-methylpiperazine-1-carboxylate |
| InChIKey | JRPIQMPFKMFAOX-LLVKDONJSA-N |
| SMILES | C[C@@H]1CN(CCN1)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)