cas: 75703-11-6 — see every product listed under this CAS number, including other names
(R)-1-Cyclohexyl-2,2,2-trifluoroethan-1-amine 95% (CAS 75703-11-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A816504-100mg |
| cas | 75703-11-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 1972.38 Pln | |
| Ambeed | 250mg | 3307.38 Pln | |
| Ambeed | 1g | 8096.69 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A816504 |
(1R)-1-cyclohexyl-2,2,2-trifluoroethanamine (CAS 75703-11-6) is a chemical compound with the molecular formula C8H14F3N and a molecular weight of 181.20 g/mol. IUPAC name: (1R)-1-cyclohexyl-2,2,2-trifluoroethanamine. InChIKey: HTJYTQSIEXSPGU-SSDOTTSWSA-N.
| Molecular formula | C8H14F3N |
|---|---|
| Molecular weight | 181.20 g/mol |
| IUPAC name | (1R)-1-cyclohexyl-2,2,2-trifluoroethanamine |
| InChIKey | HTJYTQSIEXSPGU-SSDOTTSWSA-N |
| SMILES | C1CCC(CC1)[C@H](C(F)(F)F)N |
Computed by PubChem (NCBI)