CAS 75703-11-6 appears in our catalog under these names: (R)-1-Cyclohexyl-2,2,2-trifluoroethylamine, 95%, (R)-1-Cyclohexyl-2,2,2-trifluoroethan-1-amine 95%. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
(1R)-1-cyclohexyl-2,2,2-trifluoroethanamine (CAS 75703-11-6) is a chemical compound with the molecular formula C8H14F3N and a molecular weight of 181.20 g/mol. IUPAC name: (1R)-1-cyclohexyl-2,2,2-trifluoroethanamine. InChIKey: HTJYTQSIEXSPGU-SSDOTTSWSA-N.
| Molecular formula | C8H14F3N |
|---|---|
| Molecular weight | 181.20 g/mol |
| IUPAC name | (1R)-1-cyclohexyl-2,2,2-trifluoroethanamine |
| InChIKey | HTJYTQSIEXSPGU-SSDOTTSWSA-N |
| SMILES | C1CCC(CC1)[C@H](C(F)(F)F)N |
Computed by PubChem (NCBI)