CAS 75703-08-1 appears in our catalog under these names: (S)-1-Cyclohexyl-2,2,2-trifluoroethylamine, 95%, (S)-1-Cyclohexyl-2,2,2-trifluoro-ethylamine. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g.
(1S)-1-cyclohexyl-2,2,2-trifluoroethanamine (CAS 75703-08-1) is a chemical compound with the molecular formula C8H14F3N and a molecular weight of 181.20 g/mol. IUPAC name: (1S)-1-cyclohexyl-2,2,2-trifluoroethanamine. InChIKey: HTJYTQSIEXSPGU-ZETCQYMHSA-N.
| Molecular formula | C8H14F3N |
|---|---|
| Molecular weight | 181.20 g/mol |
| IUPAC name | (1S)-1-cyclohexyl-2,2,2-trifluoroethanamine |
| InChIKey | HTJYTQSIEXSPGU-ZETCQYMHSA-N |
| SMILES | C1CCC(CC1)[C@@H](C(F)(F)F)N |
Computed by PubChem (NCBI)