cas: 84010-67-3 — see every product listed under this CAS number, including other names
(R)-1-Methyl-1,2,3,4-tetrahydroisoquinoline Hydrochloride, 95%, 95% (CAS 84010-67-3) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11G907-1g |
| cas | 84010-67-3 |
| size | 1g |
| availability | 361g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 6414.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(1R)-1-methyl-1,2,3,4-tetrahydroisoquinoline;hydrochloride (CAS 84010-67-3) is a chemical compound with the molecular formula C10H14ClN and a molecular weight of 183.68 g/mol. IUPAC name: (1R)-1-methyl-1,2,3,4-tetrahydroisoquinoline;hydrochloride. InChIKey: CFEGVJOLMOPMHU-DDWIOCJRSA-N.
| Molecular formula | C10H14ClN |
|---|---|
| Molecular weight | 183.68 g/mol |
| IUPAC name | (1R)-1-methyl-1,2,3,4-tetrahydroisoquinoline;hydrochloride |
| InChIKey | CFEGVJOLMOPMHU-DDWIOCJRSA-N |
| SMILES | C[C@@H]1C2=CC=CC=C2CCN1.Cl |
Computed by PubChem (NCBI)