CAS 64982-62-3 appears in our catalog under these names: (S)-1-Methyl-1,2,3,4-tetrahydro-isoquinoline hydrochloride, 95%, 95%, (S)-1-Methyl-1,2,3,4-tetrahydro-isoquinoline hydrochloride, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g.
(1S)-1-methyl-1,2,3,4-tetrahydroisoquinoline;hydrochloride (CAS 64982-62-3) is a chemical compound with the molecular formula C10H14ClN and a molecular weight of 183.68 g/mol. IUPAC name: (1S)-1-methyl-1,2,3,4-tetrahydroisoquinoline;hydrochloride. InChIKey: CFEGVJOLMOPMHU-QRPNPIFTSA-N.
| Molecular formula | C10H14ClN |
|---|---|
| Molecular weight | 183.68 g/mol |
| IUPAC name | (1S)-1-methyl-1,2,3,4-tetrahydroisoquinoline;hydrochloride |
| InChIKey | CFEGVJOLMOPMHU-QRPNPIFTSA-N |
| SMILES | C[C@H]1C2=CC=CC=C2CCN1.Cl |
Computed by PubChem (NCBI)