cas: 182076-49-9 — see every product listed under this CAS number, including other names
(R)-1-N-BENZYL-PROLINOL, 95%, 95% (CAS 182076-49-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1134CF-1g |
| cas | 182076-49-9 |
| size | 1g |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 477.20 Pln | |
| Chemat | 5g | 1163.60 Pln | |
| Chemat | 100mg | 198.80 Pln | |
| Chemat | 250mg | 270.80 Pln | |
| Chemat | 10g | 1854.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
[(2R)-1-benzylpyrrolidin-2-yl]methanol (CAS 182076-49-9) is a chemical compound with the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. IUPAC name: [(2R)-1-benzylpyrrolidin-2-yl]methanol. InChIKey: ZAIQBJPTOXDDKA-GFCCVEGCSA-N.
| Molecular formula | C12H17NO |
|---|---|
| Molecular weight | 191.27 g/mol |
| IUPAC name | [(2R)-1-benzylpyrrolidin-2-yl]methanol |
| InChIKey | ZAIQBJPTOXDDKA-GFCCVEGCSA-N |
| SMILES | C1C[C@@H](N(C1)CC2=CC=CC=C2)CO |
Computed by PubChem (NCBI)