cas: 182076-49-9 — see every product listed under this CAS number, including other names
(R)-1-N-Benzyl-prolinol, 97% (CAS 182076-49-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F040454-1G |
| cas | 182076-49-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 513.38 Pln | |
| Fluorochem | 5g | 1403.69 Pln | |
| Fluorochem | 25g | 4767.09 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
[(2R)-1-benzylpyrrolidin-2-yl]methanol (CAS 182076-49-9) is a chemical compound with the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. IUPAC name: [(2R)-1-benzylpyrrolidin-2-yl]methanol. InChIKey: ZAIQBJPTOXDDKA-GFCCVEGCSA-N.
| Molecular formula | C12H17NO |
|---|---|
| Molecular weight | 191.27 g/mol |
| IUPAC name | [(2R)-1-benzylpyrrolidin-2-yl]methanol |
| InChIKey | ZAIQBJPTOXDDKA-GFCCVEGCSA-N |
| SMILES | C1C[C@@H](N(C1)CC2=CC=CC=C2)CO |
Computed by PubChem (NCBI)