CAS 182076-49-9 appears in our catalog under these names: (R)-1-N-Benzyl-prolinol, 96%, (R)-1-N-BENZYL-PROLINOL, 95%, 95%, (R)-1-N-Benzyl-prolinol, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 25g, 1g, 100mg, 250mg.
[(2R)-1-benzylpyrrolidin-2-yl]methanol (CAS 182076-49-9) is a chemical compound with the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. IUPAC name: [(2R)-1-benzylpyrrolidin-2-yl]methanol. InChIKey: ZAIQBJPTOXDDKA-GFCCVEGCSA-N.
| Molecular formula | C12H17NO |
|---|---|
| Molecular weight | 191.27 g/mol |
| IUPAC name | [(2R)-1-benzylpyrrolidin-2-yl]methanol |
| InChIKey | ZAIQBJPTOXDDKA-GFCCVEGCSA-N |
| SMILES | C1C[C@@H](N(C1)CC2=CC=CC=C2)CO |
Computed by PubChem (NCBI)