cas: 252990-05-9 — see every product listed under this CAS number, including other names
(R)-1-N-Boc-piperazine-2-carboxylic acid methyl ester, 95% (CAS 252990-05-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F040898-1G |
| cas | 252990-05-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 185.37 Pln | |
| Fluorochem | 5g | 435.28 Pln | |
| Fluorochem | 10g | 726.85 Pln | |
| Fluorochem | 25g | 1565.09 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
1-O-tert-butyl 2-O-methyl (2R)-piperazine-1,2-dicarboxylate (CAS 252990-05-9) is a chemical compound with the molecular formula C11H20N2O4 and a molecular weight of 244.29 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2R)-piperazine-1,2-dicarboxylate. InChIKey: BRXKHIPPSTYCKO-MRVPVSSYSA-N.
| Molecular formula | C11H20N2O4 |
|---|---|
| Molecular weight | 244.29 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2R)-piperazine-1,2-dicarboxylate |
| InChIKey | BRXKHIPPSTYCKO-MRVPVSSYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCNC[C@@H]1C(=O)OC |
Computed by PubChem (NCBI)